C29H38OSi — CID 18622638
4,4-bis(1H-inden-1-yl)pentoxy-triethylsilane (PubChem CID 18622638) has the molecular formula C29H38OSi and a molecular weight of 430.71 g/mol. Its IUPAC name is 4,4-bis(1H-inden-1-yl)pentoxy-triethylsilane.
| Compound Name | 4,4-bis(1H-inden-1-yl)pentoxy-triethylsilane |
|---|---|
| PubChem CID | 18622638 |
| Molecular Formula | C29H38OSi |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4,4-bis(1H-inden-1-yl)pentoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCCCC(C)(C1C=Cc2ccccc21)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C29H38OSi/c1-5-31(6-2,7-3)30-22-12-21-29(4,27-19-17-23-13-8-10-15-25(23)27)28-20-18-24-14-9-11-16-26(24)28/h8-11,13-20,27-28H,5-7,12,21-22H2,1-4H3 |
| InChIKey | NZJSZPXNQUMGLH-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|