About chromium(2+);bis(oxido-oxo-pentylphosphanium)
chromium(2+);bis(oxido-oxo-pentylphosphanium) (PubChem CID 18626741) has the molecular formula C10H22CrO4P2+2
and a molecular weight of 320.23 g/mol. Its IUPAC name is chromium(2+);bis(oxido-oxo-pentylphosphanium).
Molecular Properties
| Compound Name | chromium(2+);bis(oxido-oxo-pentylphosphanium) |
| PubChem CID | 18626741 |
| Molecular Formula | C10H22CrO4P2+2 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | chromium(2+);bis(oxido-oxo-pentylphosphanium) |
| SMILES | CCCCC[P+](=O)[O-].CCCCC[P+](=O)[O-].[Cr+2] |
| InChI | InChI=1S/2C5H11O2P.Cr/c2*1-2-3-4-5-8(6)7;/h2*2-5H2,1H3;/q;;+2 |
| InChIKey | HYDVJWWKPYFYRU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chromium(2+);bis(oxido-oxo-pentylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(2+);bis(oxido-oxo-pentylphosphanium)?
The IUPAC name of chromium(2+);bis(oxido-oxo-pentylphosphanium) (CID 18626741) is chromium(2+);bis(oxido-oxo-pentylphosphanium).
What is the SMILES notation for chromium(2+);bis(oxido-oxo-pentylphosphanium)?
The canonical SMILES for chromium(2+);bis(oxido-oxo-pentylphosphanium) is CCCCC[P+](=O)[O-].CCCCC[P+](=O)[O-].[Cr+2].
What is the InChIKey of chromium(2+);bis(oxido-oxo-pentylphosphanium)?
The InChIKey is HYDVJWWKPYFYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11O2P.Cr/c2*1-2-3-4-5-8(6)7;/h2*2-5H2,1H3;/q;;+2.
What are the key properties of chromium(2+);bis(oxido-oxo-pentylphosphanium)?
chromium(2+);bis(oxido-oxo-pentylphosphanium) has a molecular weight of 320.23 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(2+);bis(oxido-oxo-pentylphosphanium) is sourced from PubChem (CID 18626741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).