C21H19ClO5 — CID 18631954
benzyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate (PubChem CID 18631954) has the molecular formula C21H19ClO5 and a molecular weight of 386.83 g/mol. Its IUPAC name is benzyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate.
| Compound Name | benzyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate |
|---|---|
| PubChem CID | 18631954 |
| Molecular Formula | C21H19ClO5 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | benzyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate |
| SMILES | O=C(COCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21)OCc1ccccc1 |
| InChI | InChI=1S/C21H19ClO5/c22-14-6-13(10-24-11-18(23)25-9-12-4-2-1-3-5-12)20-15(7-14)19-16(26-20)8-17-21(19)27-17/h1-7,16-17,19,21H,8-11H2/t16?,17-,19?,21-/m1/s1 |
| InChIKey | SBESAASCEVYRDU-OQOZKDDRSA-N |
| XLogP | 3.62 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|