C16H17ClO5 — CID 18601311
ethyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate (PubChem CID 18601311) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is ethyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate.
| Compound Name | ethyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate |
|---|---|
| PubChem CID | 18601311 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | ethyl 2-[[(3S,5R)-12-chloro-4,8-dioxatetracyclo[7.4.0.02,7.03,5]trideca-1(13),9,11-trien-10-yl]methoxy]acetate |
| SMILES | CCOC(=O)COCc1cc(Cl)cc2c1OC1C[C@H]3O[C@H]3C21 |
| InChI | InChI=1S/C16H17ClO5/c1-2-20-13(18)7-19-6-8-3-9(17)4-10-14-11(21-15(8)10)5-12-16(14)22-12/h3-4,11-12,14,16H,2,5-7H2,1H3/t11?,12-,14?,16-/m1/s1 |
| InChIKey | KYMJENRHMVENKY-XHKQLBEBSA-N |
| XLogP | 2.44 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|