C27H38N4O8S — CID 18632164
(2S,3aS,7aS)-1-[(4R)-4-[[(2R)-3-(2-aminoethylsulfanyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 18632164) has the molecular formula C27H38N4O8S and a molecular weight of 578.69 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(4R)-4-[[(2R)-3-(2-aminoethylsulfanyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2R)-3-(2-aminoethylsulfanyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 18632164 |
| Molecular Formula | C27H38N4O8S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2R)-3-(2-aminoethylsulfanyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | NCCSC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](CCC(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21)C(=O)O |
| InChI | InChI=1S/C27H38N4O8S/c28-12-13-40-16-20(30-27(38)39-15-17-6-2-1-3-7-17)24(33)29-19(25(34)35)10-11-23(32)31-21-9-5-4-8-18(21)14-22(31)26(36)37/h1-3,6-7,18-22H,4-5,8-16,28H2,(H,29,33)(H,30,38)(H,34,35)(H,36,37)/t18-,19+,20-,21-,22-/m0/s1 |
| InChIKey | YUOWHXCICQPWKG-WIYBCGNWSA-N |
| XLogP | 1.57 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|