C27H38ClN5O8 — CID 70052184
(2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(3-chloro-2-pyridinyl)methoxycarbonylamino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 70052184) has the molecular formula C27H38ClN5O8 and a molecular weight of 596.08 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(3-chloro-2-pyridinyl)methoxycarbonylamino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(3-chloro-2-pyridinyl)methoxycarbonylamino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 70052184 |
| Molecular Formula | C27H38ClN5O8 |
| Molecular Weight | 596.08 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(3-chloro-2-pyridinyl)methoxycarbonylamino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | NCCCC[C@H](NC(=O)OCc1ncccc1Cl)C(=O)N[C@H](CCC(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21)C(=O)O |
| InChI | InChI=1S/C27H38ClN5O8/c28-17-7-5-13-30-20(17)15-41-27(40)32-18(8-3-4-12-29)24(35)31-19(25(36)37)10-11-23(34)33-21-9-2-1-6-16(21)14-22(33)26(38)39/h5,7,13,16,18-19,21-22H,1-4,6,8-12,14-15,29H2,(H,31,35)(H,32,40)(H,36,37)(H,38,39)/t16-,18-,19+,21-,22-/m0/s1 |
| InChIKey | UTSYCUROQHWPLD-PYDYAWQMSA-N |
| XLogP | 2.05 |
| TPSA | 201.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.08 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|