C31H45N5O9 — CID 14620263
(2S,3aS,7aS)-1-[(4R)-4-carboxy-4-[[(2S)-2-(phenylmethoxycarbonylamino)-3-(2-piperazin-1-ylethoxy)propanoyl]amino]butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 14620263) has the molecular formula C31H45N5O9 and a molecular weight of 631.73 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(4R)-4-carboxy-4-[[(2S)-2-(phenylmethoxycarbonylamino)-3-(2-piperazin-1-ylethoxy)propanoyl]amino]butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[(4R)-4-carboxy-4-[[(2S)-2-(phenylmethoxycarbonylamino)-3-(2-piperazin-1-ylethoxy)propanoyl]amino]butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 14620263 |
| Molecular Formula | C31H45N5O9 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.32 |
| IUPAC Name | (2S,3aS,7aS)-1-[(4R)-4-carboxy-4-[[(2S)-2-(phenylmethoxycarbonylamino)-3-(2-piperazin-1-ylethoxy)propanoyl]amino]butanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(N[C@@H](COCCN1CCNCC1)C(=O)N[C@H](CCC(=O)N1[C@H](C(=O)O)C[C@@H]2CCCC[C@@H]21)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C31H45N5O9/c37-27(36-25-9-5-4-8-22(25)18-26(36)30(41)42)11-10-23(29(39)40)33-28(38)24(20-44-17-16-35-14-12-32-13-15-35)34-31(43)45-19-21-6-2-1-3-7-21/h1-3,6-7,22-26,32H,4-5,8-20H2,(H,33,38)(H,34,43)(H,39,40)(H,41,42)/t22-,23+,24-,25-,26-/m0/s1 |
| InChIKey | SEMZKVPAGFGCQQ-UUNMLIRYSA-N |
| XLogP | 0.80 |
| TPSA | 186.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|