C28H40N4O8 — CID 15631063
(2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 15631063) has the molecular formula C28H40N4O8 and a molecular weight of 560.65 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 15631063 |
| Molecular Formula | C28H40N4O8 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | (2S,3aS,7aS)-1-[(4R)-4-[[(2S)-6-amino-2-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)N[C@@H](CCCCN)C(=O)N[C@H](CCC(=O)N2[C@H](C(=O)O)C[C@@H]3CCCC[C@@H]32)C(=O)O)cc1 |
| InChI | InChI=1S/C28H40N4O8/c1-40-19-11-9-17(10-12-19)25(34)30-20(7-4-5-15-29)26(35)31-21(27(36)37)13-14-24(33)32-22-8-3-2-6-18(22)16-23(32)28(38)39/h9-12,18,20-23H,2-8,13-16,29H2,1H3,(H,30,34)(H,31,35)(H,36,37)(H,38,39)/t18-,20-,21+,22-,23-/m0/s1 |
| InChIKey | ZNOJDRWWNODXGJ-LCNLMQJVSA-N |
| XLogP | 1.52 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|