C26H38N6O6 — CID 71339249
1-[5-amino-2-[[6-amino-2-(pyridine-3-carbonylamino)hexanoyl]amino]-5-oxopentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 71339249) has the molecular formula C26H38N6O6 and a molecular weight of 530.63 g/mol. Its IUPAC name is 1-[5-amino-2-[[6-amino-2-(pyridine-3-carbonylamino)hexanoyl]amino]-5-oxopentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[5-amino-2-[[6-amino-2-(pyridine-3-carbonylamino)hexanoyl]amino]-5-oxopentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 71339249 |
| Molecular Formula | C26H38N6O6 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 1-[5-amino-2-[[6-amino-2-(pyridine-3-carbonylamino)hexanoyl]amino]-5-oxopentanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | NCCCCC(NC(=O)c1cccnc1)C(=O)NC(CCC(N)=O)C(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C26H38N6O6/c27-12-4-3-8-18(30-23(34)17-7-5-13-29-15-17)24(35)31-19(10-11-22(28)33)25(36)32-20-9-2-1-6-16(20)14-21(32)26(37)38/h5,7,13,15-16,18-21H,1-4,6,8-12,14,27H2,(H2,28,33)(H,30,34)(H,31,35)(H,37,38) |
| InChIKey | NOFGQEQHEIOIBW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 197.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|