C34H48O2 — CID 18634629
(2S,3S)-2-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-2,15-dimethyl-8-phenylmethoxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methylhept-4-yn-3-ol (PubChem CID 18634629) has the molecular formula C34H48O2 and a molecular weight of 488.76 g/mol. Its IUPAC name is (2S,3S)-2-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-2,15-dimethyl-8-phenylmethoxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methylhept-4-yn-3-ol.
| Compound Name | (2S,3S)-2-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-2,15-dimethyl-8-phenylmethoxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methylhept-4-yn-3-ol |
|---|---|
| PubChem CID | 18634629 |
| Molecular Formula | C34H48O2 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | (2S,3S)-2-[(1S,2R,5S,7R,8R,10S,11S,14R,15S)-2,15-dimethyl-8-phenylmethoxy-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl]-6-methylhept-4-yn-3-ol |
| SMILES | CC(C)C#C[C@@H](O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](OCc4ccccc4)[C@]45C[C@@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H48O2/c1-22(2)11-14-30(35)23(3)27-12-13-28-26-19-31(36-21-24-9-7-6-8-10-24)34-20-25(34)15-18-33(34,5)29(26)16-17-32(27,28)4/h6-10,22-23,25-31,35H,12-13,15-21H2,1-5H3/t23-,25-,26-,27+,28-,29-,30+,31+,32+,33+,34-/m0/s1 |
| InChIKey | OMPJBVIWAFUPFE-JEEHZOIKSA-N |
| XLogP | 7.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|