C20H36N3O6P — CID 18636022
(2,6-dioxopiperidin-1-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid (PubChem CID 18636022) has the molecular formula C20H36N3O6P and a molecular weight of 445.50 g/mol. Its IUPAC name is (2,6-dioxopiperidin-1-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid.
| Compound Name | (2,6-dioxopiperidin-1-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
|---|---|
| PubChem CID | 18636022 |
| Molecular Formula | C20H36N3O6P |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (2,6-dioxopiperidin-1-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)C(CC(C)C)CP(=O)(O)CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C20H36N3O6P/c1-13(2)9-15(19(26)22-16(10-14(3)4)20(27)21-5)11-30(28,29)12-23-17(24)7-6-8-18(23)25/h13-16H,6-12H2,1-5H3,(H,21,27)(H,22,26)(H,28,29)/t15?,16-/m0/s1 |
| InChIKey | HTNANCWFLPVDPU-LYKKTTPLSA-N |
| XLogP | 1.69 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|