C22H42N4O5 — CID 18637551
(2R)-2-[(2S)-9-amino-1-ethoxy-1-oxononan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18637551) has the molecular formula C22H42N4O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2R)-2-[(2S)-9-amino-1-ethoxy-1-oxononan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-[(2S)-9-amino-1-ethoxy-1-oxononan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18637551 |
| Molecular Formula | C22H42N4O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | (2R)-2-[(2S)-9-amino-1-ethoxy-1-oxononan-2-yl]-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@@H](CCCCCCCN)[C@@]1(C(=O)O)CCCN1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C22H42N4O5/c1-2-31-20(28)17(11-6-4-3-5-8-14-23)22(21(29)30)13-10-16-26(22)19(27)18(25)12-7-9-15-24/h17-18H,2-16,23-25H2,1H3,(H,29,30)/t17-,18+,22-/m1/s1 |
| InChIKey | KOHXTXWOOXWFQW-KGVIQGDOSA-N |
| XLogP | 1.37 |
| TPSA | 161.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|