C21H35N3O5 — CID 18635450
(2R)-2-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18635450) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-2-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-2-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18635450 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (2R)-2-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)N1CCC[C@]1(C(=O)O)C1CC(C2CCCCC2)OC1=O |
| InChI | InChI=1S/C21H35N3O5/c22-11-5-4-9-16(23)18(25)24-12-6-10-21(24,20(27)28)15-13-17(29-19(15)26)14-7-2-1-3-8-14/h14-17H,1-13,22-23H2,(H,27,28)/t15?,16-,17?,21+/m0/s1 |
| InChIKey | RJPKTLYXFRSSJC-NNXXQBJGSA-N |
| XLogP | 1.40 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|