C27H29N3O3 — CID 18649311
4,7,7-trimethyl-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-oxobicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 18649311) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4,7,7-trimethyl-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-oxobicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 4,7,7-trimethyl-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 18649311 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4,7,7-trimethyl-N-[(3R)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-oxobicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)C2C(=O)C3(C)CCC2C3(C)C)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H29N3O3/c1-26(2)18-14-15-27(26,3)22(31)20(18)24(32)29-23-25(33)30(4)19-13-9-8-12-17(19)21(28-23)16-10-6-5-7-11-16/h5-13,18,20,23H,14-15H2,1-4H3,(H,29,32)/t18?,20?,23-,27?/m0/s1 |
| InChIKey | UHCVBWLNRQZJIZ-HWRLVTKVSA-N |
| XLogP | 3.58 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|