C14H20Cl3NO — CID 18655230
(2S)-3-(3,4-dichlorophenyl)-2-methyl-2-[methyl(prop-2-enyl)amino]propan-1-ol;hydrochloride (PubChem CID 18655230) has the molecular formula C14H20Cl3NO and a molecular weight of 324.68 g/mol. Its IUPAC name is (2S)-3-(3,4-dichlorophenyl)-2-methyl-2-[methyl(prop-2-enyl)amino]propan-1-ol;hydrochloride.
| Compound Name | (2S)-3-(3,4-dichlorophenyl)-2-methyl-2-[methyl(prop-2-enyl)amino]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 18655230 |
| Molecular Formula | C14H20Cl3NO |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (2S)-3-(3,4-dichlorophenyl)-2-methyl-2-[methyl(prop-2-enyl)amino]propan-1-ol;hydrochloride |
| SMILES | C=CCN(C)[C@](C)(CO)Cc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C14H19Cl2NO.ClH/c1-4-7-17(3)14(2,10-18)9-11-5-6-12(15)13(16)8-11;/h4-6,8,18H,1,7,9-10H2,2-3H3;1H/t14-;/m0./s1 |
| InChIKey | IWKTZWYHXZSPAS-UQKRIMTDSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|