C20H24FNO3 — CID 18678210
3-[4-[4-[(4-fluorophenyl)methyl]phenoxy]butylamino]propanoic acid (PubChem CID 18678210) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-[4-[4-[(4-fluorophenyl)methyl]phenoxy]butylamino]propanoic acid.
| Compound Name | 3-[4-[4-[(4-fluorophenyl)methyl]phenoxy]butylamino]propanoic acid |
|---|---|
| PubChem CID | 18678210 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[4-[4-[(4-fluorophenyl)methyl]phenoxy]butylamino]propanoic acid |
| SMILES | O=C(O)CCNCCCCOc1ccc(Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FNO3/c21-18-7-3-16(4-8-18)15-17-5-9-19(10-6-17)25-14-2-1-12-22-13-11-20(23)24/h3-10,22H,1-2,11-15H2,(H,23,24) |
| InChIKey | XIHZIZDRISBIKN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|