C5H8N2S — CID 18684902
2,4-dimethyl-1,3-thiazol-5-amine (PubChem CID 18684902) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazol-5-amine.
| Compound Name | 2,4-dimethyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 18684902 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 2,4-dimethyl-1,3-thiazol-5-amine |
| SMILES | Cc1nc(C)c(N)s1 |
| InChI | InChI=1S/C5H8N2S/c1-3-5(6)8-4(2)7-3/h6H2,1-2H3 |
| InChIKey | QYUDQIWSDAOUAS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |