C6H12Cl2N2S — CID 75480144
2-ethyl-4-methyl-1,3-thiazol-5-amine;dihydrochloride (PubChem CID 75480144) has the molecular formula C6H12Cl2N2S and a molecular weight of 215.15 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,3-thiazol-5-amine;dihydrochloride.
| Compound Name | 2-ethyl-4-methyl-1,3-thiazol-5-amine;dihydrochloride |
|---|---|
| PubChem CID | 75480144 |
| Molecular Formula | C6H12Cl2N2S |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-ethyl-4-methyl-1,3-thiazol-5-amine;dihydrochloride |
| SMILES | CCc1nc(C)c(N)s1.Cl.Cl |
| InChI | InChI=1S/C6H10N2S.2ClH/c1-3-5-8-4(2)6(7)9-5;;/h3,7H2,1-2H3;2*1H |
| InChIKey | HKRYJDDELDYMSS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |