C12H20N2 — CID 18686295
2-ethyl-3-propan-2-yl-4,5,6,7-tetrahydroindazole (PubChem CID 18686295) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-ethyl-3-propan-2-yl-4,5,6,7-tetrahydroindazole.
| Compound Name | 2-ethyl-3-propan-2-yl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 18686295 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-ethyl-3-propan-2-yl-4,5,6,7-tetrahydroindazole |
| SMILES | CCn1nc2c(c1C(C)C)CCCC2 |
| InChI | InChI=1S/C12H20N2/c1-4-14-12(9(2)3)10-7-5-6-8-11(10)13-14/h9H,4-8H2,1-3H3 |
| InChIKey | LWXIYNKOFQKRCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |