C23H27FN6O — CID 18693483
(3E)-3-[amino(dimethylamino)methylidene]-2-[3-[1-[4-(2-fluorophenyl)phenyl]ethyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine (PubChem CID 18693483) has the molecular formula C23H27FN6O and a molecular weight of 422.51 g/mol. Its IUPAC name is (3E)-3-[amino(dimethylamino)methylidene]-2-[3-[1-[4-(2-fluorophenyl)phenyl]ethyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine.
| Compound Name | (3E)-3-[amino(dimethylamino)methylidene]-2-[3-[1-[4-(2-fluorophenyl)phenyl]ethyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 18693483 |
| Molecular Formula | C23H27FN6O |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (3E)-3-[amino(dimethylamino)methylidene]-2-[3-[1-[4-(2-fluorophenyl)phenyl]ethyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine |
| SMILES | CC(c1ccc(-c2ccccc2F)cc1)c1cc(/N=C(\N=C(/N)N(C)C)N(C)C)on1 |
| InChI | InChI=1S/C23H27FN6O/c1-15(16-10-12-17(13-11-16)18-8-6-7-9-19(18)24)20-14-21(31-28-20)26-23(30(4)5)27-22(25)29(2)3/h6-15H,1-5H3,(H2,25,26,27) |
| InChIKey | YRXREKZZQSQMIH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|