C21H21FN4O — CID 18693543
2-[3-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine (PubChem CID 18693543) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-[3-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine.
| Compound Name | 2-[3-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 18693543 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-[3-[1-(3-fluoro-4-phenylphenyl)cyclopropyl]-1,2-oxazol-5-yl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/c1cc(C2(c3ccc(-c4ccccc4)c(F)c3)CC2)no1 |
| InChI | InChI=1S/C21H21FN4O/c1-26(2)20(23)24-19-13-18(25-27-19)21(10-11-21)15-8-9-16(17(22)12-15)14-6-4-3-5-7-14/h3-9,12-13H,10-11H2,1-2H3,(H2,23,24) |
| InChIKey | FXWLHUNAQRJVGX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|