C20H22N4OS2 — CID 18699995
N-[3-[5-(azepan-1-ylmethyl)thiophen-2-yl]-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 18699995) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is N-[3-[5-(azepan-1-ylmethyl)thiophen-2-yl]-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | N-[3-[5-(azepan-1-ylmethyl)thiophen-2-yl]-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 18699995 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[3-[5-(azepan-1-ylmethyl)thiophen-2-yl]-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(CN3CCCCCC3)s2)ns1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS2/c25-19(15-8-4-3-5-9-15)22-20-21-18(23-27-20)17-11-10-16(26-17)14-24-12-6-1-2-7-13-24/h3-5,8-11H,1-2,6-7,12-14H2,(H,21,22,23,25) |
| InChIKey | LTTIJBKTPWBPBE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |