C16H12N2O5S — CID 18701817
[3-(4-sulfamoylphenyl)phenyl] 1,3-oxazole-2-carboxylate (PubChem CID 18701817) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is [3-(4-sulfamoylphenyl)phenyl] 1,3-oxazole-2-carboxylate.
| Compound Name | [3-(4-sulfamoylphenyl)phenyl] 1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 18701817 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [3-(4-sulfamoylphenyl)phenyl] 1,3-oxazole-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(-c2cccc(OC(=O)c3ncco3)c2)cc1 |
| InChI | InChI=1S/C16H12N2O5S/c17-24(20,21)14-6-4-11(5-7-14)12-2-1-3-13(10-12)23-16(19)15-18-8-9-22-15/h1-10H,(H2,17,20,21) |
| InChIKey | CFQSOIXAUOHOLF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|