C30H38O12 — CID 18703948
2-[[8-(3-carboxypropanoyloxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 18703948) has the molecular formula C30H38O12 and a molecular weight of 590.62 g/mol. Its IUPAC name is 2-[[8-(3-carboxypropanoyloxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | 2-[[8-(3-carboxypropanoyloxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18703948 |
| Molecular Formula | C30H38O12 |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-[[8-(3-carboxypropanoyloxy)-9-hydroxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-9-formyl-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC(C)C1=CC2CC3(C=O)C4CCC(C)C4CC2(COC24OC5OC(C(OC(=O)CCC(=O)O)C5O2)C4O)C13C(=O)O |
| InChI | InChI=1S/C30H38O12/c1-13(2)18-8-15-9-27(11-31)17-5-4-14(3)16(17)10-28(15,29(18,27)26(36)37)12-38-30-24(35)22-21(23(41-30)25(40-22)42-30)39-20(34)7-6-19(32)33/h8,11,13-17,21-25,35H,4-7,9-10,12H2,1-3H3,(H,32,33)(H,36,37) |
| InChIKey | GZTAEHNEZRHXEL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|