C6H5ClN4S2 — CID 18707776
5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 18707776) has the molecular formula C6H5ClN4S2 and a molecular weight of 232.72 g/mol. Its IUPAC name is 5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18707776 |
| Molecular Formula | C6H5ClN4S2 |
| Molecular Weight | 232.72 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 5-chloro-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | Cn1cnnc1Sc1ncc(Cl)s1 |
| InChI | InChI=1S/C6H5ClN4S2/c1-11-3-9-10-5(11)13-6-8-2-4(7)12-6/h2-3H,1H3 |
| InChIKey | XXWLGAOBNWSXTM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|