C39H38N3OP+2 — CID 18711191
[1-[2-[2-[2-(1-methylquinolin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-1-oxopropan-2-yl]-triphenylphosphanium (PubChem CID 18711191) has the molecular formula C39H38N3OP+2 and a molecular weight of 595.73 g/mol. Its IUPAC name is [1-[2-[2-[2-(1-methylquinolin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-1-oxopropan-2-yl]-triphenylphosphanium.
| Compound Name | [1-[2-[2-[2-(1-methylquinolin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-1-oxopropan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 18711191 |
| Molecular Formula | C39H38N3OP+2 |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | [1-[2-[2-[2-(1-methylquinolin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-1-oxopropan-2-yl]-triphenylphosphanium |
| SMILES | CC(C(=O)NNc1ccccc1CCc1cc[n+](C)c2ccccc12)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H37N3OP/c1-30(44(33-17-6-3-7-18-33,34-19-8-4-9-20-34)35-21-10-5-11-22-35)39(43)41-40-37-24-14-12-16-32(37)27-26-31-28-29-42(2)38-25-15-13-23-36(31)38/h3-25,28-30,40H,26-27H2,1-2H3/q+1/p+1 |
| InChIKey | OXVMVEZVCSOMPW-UHFFFAOYSA-O |
| XLogP | 6.28 |
| TPSA | 45.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|