C17H19AcFN5O4- — CID 18713333
actinium;[3-[4-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide (PubChem CID 18713333) has the molecular formula C17H19AcFN5O4- and a molecular weight of 603.37 g/mol. Its IUPAC name is actinium;[3-[4-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide.
| Compound Name | actinium;[3-[4-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide |
|---|---|
| PubChem CID | 18713333 |
| Molecular Formula | C17H19AcFN5O4- |
| Molecular Weight | 603.37 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | actinium;[3-[4-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methylazanide |
| SMILES | [Ac].[NH-]CC1CN(c2ccc(N3CCC4(CC3)NC(=O)NC4=O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H19FN5O4.Ac/c18-12-7-10(23-9-11(8-19)27-16(23)26)1-2-13(12)22-5-3-17(4-6-22)14(24)20-15(25)21-17;/h1-2,7,11,19H,3-6,8-9H2,(H2,20,21,24,25);/q-1; |
| InChIKey | XZOFRNFOZBGWQS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|