C11H21NaO5S — CID 18716855
sodium 3-(2-ethylhexoxy)-3-oxopropane-1-sulfonate (PubChem CID 18716855) has the molecular formula C11H21NaO5S and a molecular weight of 288.34 g/mol. Its IUPAC name is sodium 3-(2-ethylhexoxy)-3-oxopropane-1-sulfonate.
| Compound Name | sodium 3-(2-ethylhexoxy)-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 18716855 |
| Molecular Formula | C11H21NaO5S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | sodium 3-(2-ethylhexoxy)-3-oxopropane-1-sulfonate |
| SMILES | CCCCC(CC)COC(=O)CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C11H22O5S.Na/c1-3-5-6-10(4-2)9-16-11(12)7-8-17(13,14)15;/h10H,3-9H2,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | AGSBCQOLMMMABQ-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|