C24H32Cl2FeN3O2 — CID 18719202
bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) (PubChem CID 18719202) has the molecular formula C24H32Cl2FeN3O2 and a molecular weight of 521.29 g/mol. Its IUPAC name is bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+).
| Compound Name | bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) |
|---|---|
| PubChem CID | 18719202 |
| Molecular Formula | C24H32Cl2FeN3O2 |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | bis[1-methoxy-2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) |
| SMILES | COC(/C=N/c1c(C)cc(C)cc1C)[N-]C(/C=N/c1c(C)cc(C)cc1C)OC.Cl[Fe+]Cl |
| InChI | InChI=1S/C24H32N3O2.2ClH.Fe/c1-15-9-17(3)23(18(4)10-15)25-13-21(28-7)27-22(29-8)14-26-24-19(5)11-16(2)12-20(24)6;;;/h9-14,21-22H,1-8H3;2*1H;/q-1;;;+3/p-2/b25-13+,26-14+;;; |
| InChIKey | MPEATEIGQUBFMS-CWPMVNKHSA-L |
| XLogP | 7.34 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|