C11H8NO3+ — CID 18721310
3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-5-carboxylic acid (PubChem CID 18721310) has the molecular formula C11H8NO3+ and a molecular weight of 202.19 g/mol. Its IUPAC name is 3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-5-carboxylic acid.
| Compound Name | 3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-5-carboxylic acid |
|---|---|
| PubChem CID | 18721310 |
| Molecular Formula | C11H8NO3+ |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccc[n+]3c2c1OC3 |
| InChI | InChI=1S/C11H7NO3/c13-11(14)8-4-3-7-2-1-5-12-6-15-10(8)9(7)12/h1-5H,6H2/p+1 |
| InChIKey | RBFXBNUAOGMQMX-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|