C21H15O2- — CID 18724779
2-[(E,3Z)-3-(3-oxo-1H-inden-2-ylidene)prop-1-enyl]-3H-inden-1-olate (PubChem CID 18724779) has the molecular formula C21H15O2- and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(3-oxo-1H-inden-2-ylidene)prop-1-enyl]-3H-inden-1-olate.
| Compound Name | 2-[(E,3Z)-3-(3-oxo-1H-inden-2-ylidene)prop-1-enyl]-3H-inden-1-olate |
|---|---|
| PubChem CID | 18724779 |
| Molecular Formula | C21H15O2- |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[(E,3Z)-3-(3-oxo-1H-inden-2-ylidene)prop-1-enyl]-3H-inden-1-olate |
| SMILES | O=C1/C(=C\C=C\C2=C([O-])c3ccccc3C2)Cc2ccccc21 |
| InChI | InChI=1S/C21H16O2/c22-20-16(12-14-6-1-3-10-18(14)20)8-5-9-17-13-15-7-2-4-11-19(15)21(17)23/h1-11,22H,12-13H2/p-1/b8-5+,17-9- |
| InChIKey | NVNLYYCCQKBVOW-WIXUPIFPSA-M |
| XLogP | 3.24 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|