C25H17O4- — CID 123808299
2-[5-(1,3-dioxo-4H-naphthalen-2-ylidene)penta-1,3-dienyl]-3-oxo-4H-naphthalen-1-olate (PubChem CID 123808299) has the molecular formula C25H17O4- and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[5-(1,3-dioxo-4H-naphthalen-2-ylidene)penta-1,3-dienyl]-3-oxo-4H-naphthalen-1-olate.
| Compound Name | 2-[5-(1,3-dioxo-4H-naphthalen-2-ylidene)penta-1,3-dienyl]-3-oxo-4H-naphthalen-1-olate |
|---|---|
| PubChem CID | 123808299 |
| Molecular Formula | C25H17O4- |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-[5-(1,3-dioxo-4H-naphthalen-2-ylidene)penta-1,3-dienyl]-3-oxo-4H-naphthalen-1-olate |
| SMILES | O=C1Cc2ccccc2C(=O)C1=CC=CC=CC1=C([O-])c2ccccc2CC1=O |
| InChI | InChI=1S/C25H18O4/c26-22-14-16-8-4-6-10-18(16)24(28)20(22)12-2-1-3-13-21-23(27)15-17-9-5-7-11-19(17)25(21)29/h1-13,28H,14-15H2/p-1 |
| InChIKey | NVMVWOWWJNYQPP-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|