C9H7F12NO — CID 18731743
1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-2,2,3,3,5,5,6,6-octafluoropiperidine (PubChem CID 18731743) has the molecular formula C9H7F12NO and a molecular weight of 373.14 g/mol. Its IUPAC name is 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-2,2,3,3,5,5,6,6-octafluoropiperidine.
| Compound Name | 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-2,2,3,3,5,5,6,6-octafluoropiperidine |
|---|---|
| PubChem CID | 18731743 |
| Molecular Formula | C9H7F12NO |
| Molecular Weight | 373.14 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 1-(2-ethoxy-1,1,2,2-tetrafluoroethyl)-2,2,3,3,5,5,6,6-octafluoropiperidine |
| SMILES | CCOC(F)(F)C(F)(F)N1C(F)(F)C(F)(F)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C9H7F12NO/c1-2-23-9(20,21)8(18,19)22-6(14,15)4(10,11)3-5(12,13)7(22,16)17/h2-3H2,1H3 |
| InChIKey | RLOXKGAIXIHILB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|