C8H4F13NO — CID 155217347
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2-trifluoro-2-methoxyethyl)piperidine (PubChem CID 155217347) has the molecular formula C8H4F13NO and a molecular weight of 377.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2-trifluoro-2-methoxyethyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2-trifluoro-2-methoxyethyl)piperidine |
|---|---|
| PubChem CID | 155217347 |
| Molecular Formula | C8H4F13NO |
| Molecular Weight | 377.10 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,2,2-trifluoro-2-methoxyethyl)piperidine |
| SMILES | COC(F)(F)C(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H4F13NO/c1-23-3(10,11)2(9)22-7(18,19)5(14,15)4(12,13)6(16,17)8(22,20)21/h2H,1H3 |
| InChIKey | ILGQKPGRIUVNEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.10 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|