C10H13F8NO — CID 19783537
2,2,3,3,5,5,6,6-octafluoro-4-hexylmorpholine (PubChem CID 19783537) has the molecular formula C10H13F8NO and a molecular weight of 315.20 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-4-hexylmorpholine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-4-hexylmorpholine |
|---|---|
| PubChem CID | 19783537 |
| Molecular Formula | C10H13F8NO |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-4-hexylmorpholine |
| SMILES | CCCCCCN1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C10H13F8NO/c1-2-3-4-5-6-19-7(11,12)9(15,16)20-10(17,18)8(19,13)14/h2-6H2,1H3 |
| InChIKey | NNVXHDYILIMDRT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|