C11H8F15NO — CID 54540906
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)morpholine (PubChem CID 54540906) has the molecular formula C11H8F15NO and a molecular weight of 455.16 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)morpholine.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)morpholine |
|---|---|
| PubChem CID | 54540906 |
| Molecular Formula | C11H8F15NO |
| Molecular Weight | 455.16 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)morpholine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C11H8F15NO/c12-5(13,6(14,15)8(18,19)10(22,23)24)7(16,17)9(20,21)11(25,26)27-1-3-28-4-2-27/h1-4H2 |
| InChIKey | ZDDFDODUAQOLFN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.16 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|