C22H22F4N4O — CID 18734576
N-butyl-N-[[3-(cyclopropylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 18734576) has the molecular formula C22H22F4N4O and a molecular weight of 434.44 g/mol. Its IUPAC name is N-butyl-N-[[3-(cyclopropylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | N-butyl-N-[[3-(cyclopropylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 18734576 |
| Molecular Formula | C22H22F4N4O |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-butyl-N-[[3-(cyclopropylmethyl)imidazo[4,5-b]pyridin-2-yl]methyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | CCCCN(Cc1nc2cccnc2n1CC1CC1)C(=O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C22H22F4N4O/c1-2-3-9-29(22(31)18-19(25)14(23)10-15(24)20(18)26)12-17-28-16-5-4-8-27-21(16)30(17)11-13-6-7-13/h4-5,8,10,13H,2-3,6-7,9,11-12H2,1H3 |
| InChIKey | ABMSAWBOEWBRDB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|