C25H29N3O — CID 18751858
1-(4-butoxyphenyl)-3-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethylguanidine (PubChem CID 18751858) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethylguanidine.
| Compound Name | 1-(4-butoxyphenyl)-3-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 18751858 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(1,2-dihydroacenaphthylen-5-yl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1ccc(OCCCC)cc1)N(C)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C25H29N3O/c1-4-5-17-29-21-14-12-20(13-15-21)27(2)25(26)28(3)23-16-11-19-10-9-18-7-6-8-22(23)24(18)19/h6-8,11-16,26H,4-5,9-10,17H2,1-3H3/b26-25+ |
| InChIKey | NBFOXRCHKCRZFN-OCEACIFDSA-N |
| XLogP | 5.62 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|