C28H35N3O2S — CID 18758184
7-(4-butyl-1,4-diazepan-1-yl)-3-(3-phenylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide (PubChem CID 18758184) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 7-(4-butyl-1,4-diazepan-1-yl)-3-(3-phenylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide.
| Compound Name | 7-(4-butyl-1,4-diazepan-1-yl)-3-(3-phenylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 18758184 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 7-(4-butyl-1,4-diazepan-1-yl)-3-(3-phenylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
| SMILES | CCCCN1CCCN(c2ccc3c4c(cccc24)S(=O)(=O)N3CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H35N3O2S/c1-2-3-17-29-18-9-19-30(22-21-29)25-15-16-26-28-24(25)13-7-14-27(28)34(32,33)31(26)20-8-12-23-10-5-4-6-11-23/h4-7,10-11,13-16H,2-3,8-9,12,17-22H2,1H3 |
| InChIKey | XSXYWVBQARXVQB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |