C20H27N3O2S — CID 18758144
7-(4-methyl-1,4-diazepan-1-yl)-3-(2-methylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide (PubChem CID 18758144) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 7-(4-methyl-1,4-diazepan-1-yl)-3-(2-methylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide.
| Compound Name | 7-(4-methyl-1,4-diazepan-1-yl)-3-(2-methylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 18758144 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 7-(4-methyl-1,4-diazepan-1-yl)-3-(2-methylpropyl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
| SMILES | CC(C)CN1c2ccc(N3CCCN(C)CC3)c3cccc(c23)S1(=O)=O |
| InChI | InChI=1S/C20H27N3O2S/c1-15(2)14-23-18-9-8-17(22-11-5-10-21(3)12-13-22)16-6-4-7-19(20(16)18)26(23,24)25/h4,6-9,15H,5,10-14H2,1-3H3 |
| InChIKey | AYNGZLPVIVKCFF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |