C25H35N3O2S — CID 18758035
3-(cyclohexylmethyl)-7-(4-propyl-1,4-diazepan-1-yl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide (PubChem CID 18758035) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-7-(4-propyl-1,4-diazepan-1-yl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide.
| Compound Name | 3-(cyclohexylmethyl)-7-(4-propyl-1,4-diazepan-1-yl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 18758035 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-(cyclohexylmethyl)-7-(4-propyl-1,4-diazepan-1-yl)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene 2,2-dioxide |
| SMILES | CCCN1CCCN(c2ccc3c4c(cccc24)S(=O)(=O)N3CC2CCCCC2)CC1 |
| InChI | InChI=1S/C25H35N3O2S/c1-2-14-26-15-7-16-27(18-17-26)22-12-13-23-25-21(22)10-6-11-24(25)31(29,30)28(23)19-20-8-4-3-5-9-20/h6,10-13,20H,2-5,7-9,14-19H2,1H3 |
| InChIKey | OYYJUPVYYIEQRP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |