C23H21N3O2 — CID 177480443
2-(cyclopenta-1,2,4-trien-1-ylmethyl)-6-(4-methylpiperazin-1-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 177480443) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(cyclopenta-1,2,4-trien-1-ylmethyl)-6-(4-methylpiperazin-1-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(cyclopenta-1,2,4-trien-1-ylmethyl)-6-(4-methylpiperazin-1-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 177480443 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(cyclopenta-1,2,4-trien-1-ylmethyl)-6-(4-methylpiperazin-1-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CN1CCN(c2ccc3c4c(cccc24)C(=O)N(CC2=C=CC=C2)C3=O)CC1 |
| InChI | InChI=1S/C23H21N3O2/c1-24-11-13-25(14-12-24)20-10-9-19-21-17(20)7-4-8-18(21)22(27)26(23(19)28)15-16-5-2-3-6-16/h2-5,7-10H,11-15H2,1H3 |
| InChIKey | LCBWTSBJTQDEGN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|