C20H21NO6 — CID 18760357
7-[2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]ethoxy]hept-5-ynoic acid (PubChem CID 18760357) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 7-[2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]ethoxy]hept-5-ynoic acid.
| Compound Name | 7-[2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]ethoxy]hept-5-ynoic acid |
|---|---|
| PubChem CID | 18760357 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 7-[2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]ethoxy]hept-5-ynoic acid |
| SMILES | Cc1oc(-c2ccc3c(c2)OCO3)nc1CCOCC#CCCCC(=O)O |
| InChI | InChI=1S/C20H21NO6/c1-14-16(9-11-24-10-5-3-2-4-6-19(22)23)21-20(27-14)15-7-8-17-18(12-15)26-13-25-17/h7-8,12H,2,4,6,9-11,13H2,1H3,(H,22,23) |
| InChIKey | BQZWKSULWRKVOR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|