C20H24NNaO4S — CID 173222633
sodium;hydride;2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid (PubChem CID 173222633) has the molecular formula C20H24NNaO4S and a molecular weight of 397.47 g/mol. Its IUPAC name is sodium;hydride;2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid.
| Compound Name | sodium;hydride;2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 173222633 |
| Molecular Formula | C20H24NNaO4S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | sodium;hydride;2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid |
| SMILES | Cc1ccc(-c2nc(CCOCC#CCSC(C)C(=O)O)c(C)o2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C20H23NO4S.Na.H/c1-14-6-8-17(9-7-14)19-21-18(15(2)25-19)10-12-24-11-4-5-13-26-16(3)20(22)23;;/h6-9,16H,10-13H2,1-3H3,(H,22,23);;/q;+1;-1 |
| InChIKey | JLDWKMAFPBVMMZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|