C19H23NO6S — CID 91138748
2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfonyl]ethane-1,1-diol (PubChem CID 91138748) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfonyl]ethane-1,1-diol.
| Compound Name | 2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfonyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 91138748 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[4-[2-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfonyl]ethane-1,1-diol |
| SMILES | Cc1ccc(-c2nc(CCOCC#CCS(=O)(=O)CC(O)O)c(C)o2)cc1 |
| InChI | InChI=1S/C19H23NO6S/c1-14-5-7-16(8-6-14)19-20-17(15(2)26-19)9-11-25-10-3-4-12-27(23,24)13-18(21)22/h5-8,18,21-22H,9-13H2,1-2H3 |
| InChIKey | FWWFSIXKHRZJKM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|