C22H27NO4S — CID 69423292
(2S)-2-[4-[2-[5-methyl-2-(4-propylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid (PubChem CID 69423292) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is (2S)-2-[4-[2-[5-methyl-2-(4-propylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid.
| Compound Name | (2S)-2-[4-[2-[5-methyl-2-(4-propylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 69423292 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2S)-2-[4-[2-[5-methyl-2-(4-propylphenyl)-1,3-oxazol-4-yl]ethoxy]but-2-ynylsulfanyl]propanoic acid |
| SMILES | CCCc1ccc(-c2nc(CCOCC#CCS[C@@H](C)C(=O)O)c(C)o2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-4-7-18-8-10-19(11-9-18)21-23-20(16(2)27-21)12-14-26-13-5-6-15-28-17(3)22(24)25/h8-11,17H,4,7,12-15H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | RKTRIKOQLCPQFQ-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|