C25H29NO7 — CID 18760366
2-(1,3-benzodioxol-5-yl)-5-methyl-4-[2-[6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-ynoxy]ethyl]-1,3-oxazole (PubChem CID 18760366) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-5-methyl-4-[2-[6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-ynoxy]ethyl]-1,3-oxazole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-5-methyl-4-[2-[6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-ynoxy]ethyl]-1,3-oxazole |
|---|---|
| PubChem CID | 18760366 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-5-methyl-4-[2-[6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-ynoxy]ethyl]-1,3-oxazole |
| SMILES | Cc1oc(-c2ccc3c(c2)OCO3)nc1CCOCC#CCCCC12OCC(C)(CO1)CO2 |
| InChI | InChI=1S/C25H29NO7/c1-18-20(26-23(33-18)19-7-8-21-22(13-19)29-17-28-21)9-12-27-11-6-4-3-5-10-25-30-14-24(2,15-31-25)16-32-25/h7-8,13H,3,5,9-12,14-17H2,1-2H3 |
| InChIKey | XKUWOMGAMXINIC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|