About 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one
1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one (PubChem CID 18760553) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one |
| PubChem CID | 18760553 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one |
| SMILES | CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(C)N1O |
| InChI | InChI=1S/C14H28N2O2/c1-8-14(9-2)10-15(12(3,4)5)11(17)13(6,7)16(14)18/h18H,8-10H2,1-7H3 |
| InChIKey | JVVISJABXRYDMN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one?
The IUPAC name of 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one (CID 18760553) is 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one is CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(C)N1O.
What is the InChIKey of 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one?
The InChIKey is JVVISJABXRYDMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-8-14(9-2)10-15(12(3,4)5)11(17)13(6,7)16(14)18/h18H,8-10H2,1-7H3.
What are the key properties of 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one?
1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one has a molecular weight of 256.39 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5,5-diethyl-4-hydroxy-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 18760553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).