C18H27ClN2 — CID 18778323
1-(1-adamantyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrochloride (PubChem CID 18778323) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 1-(1-adamantyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 18778323 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(1-adamantyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrochloride |
| SMILES | CC(NCc1cccnc1)C12CC3CC(CC(C3)C1)C2.Cl |
| InChI | InChI=1S/C18H26N2.ClH/c1-13(20-12-14-3-2-4-19-11-14)18-8-15-5-16(9-18)7-17(6-15)10-18;/h2-4,11,13,15-17,20H,5-10,12H2,1H3;1H |
| InChIKey | OQCCKDOTHFZVEQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |