C18H24ClN3O5 — CID 18792967
4-(3-chloropropylcarbamoylamino)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid (PubChem CID 18792967) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 4-(3-chloropropylcarbamoylamino)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid.
| Compound Name | 4-(3-chloropropylcarbamoylamino)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18792967 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-(3-chloropropylcarbamoylamino)-1-phenylmethoxycarbonylpiperidine-2-carboxylic acid |
| SMILES | O=C(NCCCCl)NC1CCN(C(=O)OCc2ccccc2)C(C(=O)O)C1 |
| InChI | InChI=1S/C18H24ClN3O5/c19-8-4-9-20-17(25)21-14-7-10-22(15(11-14)16(23)24)18(26)27-12-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12H2,(H,23,24)(H2,20,21,25) |
| InChIKey | OCFJYTWVLUDLPA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|